ID | 1144 |
Name | Alpinine |
Pubchem ID | 442162 |
KEGG ID | C09331 |
Source | Papaver alpinum |
Type | Natural |
Function | Unknown |
Drug Like Properties | Yes |
Molecular Weight | 415.48 |
Exact mass | 415.199488 |
Molecular formula | C23H29NO6 |
XlogP | 2.6 |
Topological Polar Surface Area | 58.6 |
H-Bond Donor | 0 |
H-Bond Acceptor | 7 |
Rotational Bond Count | 5 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C=C2C3C1C4=C(C(O3)OC)C(=C(C=C4)OC)OC)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]3[C@H]1C4=C([C@H](O3)OC)C(=C(C=C4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 1147 |
Name | Amurensine |
Pubchem ID | 442164 |
KEGG ID | C09333 |
Source | Papaver alpinum |
Type | Natural |
Function | Tranquilizer |
Drug Like Properties | Yes |
Molecular Weight | 325.36 |
Exact mass | 325.131408 |
Molecular formula | C19H19NO4 |
XlogP | 2.7 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CC2C3=CC(=C(C=C3CC1C4=CC5=C(C=C24)OCO5)OC)O |
Isomeric SMILE | CN1C[C@@H]2C3=CC(=C(C=C3C[C@H]1C4=CC5=C(C=C24)OCO5)OC)O |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |